C10H11ClN2O4 — CID 71325587
ethyl N-[(4-chloro-2-nitrophenyl)methyl]carbamate (PubChem CID 71325587) has the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. Its IUPAC name is ethyl N-[(4-chloro-2-nitrophenyl)methyl]carbamate.
| Compound Name | ethyl N-[(4-chloro-2-nitrophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 71325587 |
| Molecular Formula | C10H11ClN2O4 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | ethyl N-[(4-chloro-2-nitrophenyl)methyl]carbamate |
| SMILES | CCOC(=O)NCc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11ClN2O4/c1-2-17-10(14)12-6-7-3-4-8(11)5-9(7)13(15)16/h3-5H,2,6H2,1H3,(H,12,14) |
| InChIKey | OAOMUGBNWQZZQI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|