C8H13ClO4S — CID 71325864
2-[chloro(methylsulfonyl)methyl]cyclopentane-1-carboxylic acid (PubChem CID 71325864) has the molecular formula C8H13ClO4S and a molecular weight of 240.71 g/mol. Its IUPAC name is 2-[chloro(methylsulfonyl)methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[chloro(methylsulfonyl)methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 71325864 |
| Molecular Formula | C8H13ClO4S |
| Molecular Weight | 240.71 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2-[chloro(methylsulfonyl)methyl]cyclopentane-1-carboxylic acid |
| SMILES | CS(=O)(=O)C(Cl)C1CCCC1C(=O)O |
| InChI | InChI=1S/C8H13ClO4S/c1-14(12,13)7(9)5-3-2-4-6(5)8(10)11/h5-7H,2-4H2,1H3,(H,10,11) |
| InChIKey | HGBVRVHJIWMIGZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.71 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|