C24H26N2O2 — CID 71326032
5-[4-(3,7-dimethylocta-2,6-dienoxy)phenyl]-2-pyridin-3-yl-1,3-oxazole (PubChem CID 71326032) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 5-[4-(3,7-dimethylocta-2,6-dienoxy)phenyl]-2-pyridin-3-yl-1,3-oxazole.
| Compound Name | 5-[4-(3,7-dimethylocta-2,6-dienoxy)phenyl]-2-pyridin-3-yl-1,3-oxazole |
|---|---|
| PubChem CID | 71326032 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 5-[4-(3,7-dimethylocta-2,6-dienoxy)phenyl]-2-pyridin-3-yl-1,3-oxazole |
| SMILES | CC(C)=CCCC(C)=CCOc1ccc(-c2cnc(-c3cccnc3)o2)cc1 |
| InChI | InChI=1S/C24H26N2O2/c1-18(2)6-4-7-19(3)13-15-27-22-11-9-20(10-12-22)23-17-26-24(28-23)21-8-5-14-25-16-21/h5-6,8-14,16-17H,4,7,15H2,1-3H3 |
| InChIKey | SCOSSTFYVOJNFI-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|