About 3-methyl-5,7-dihydro-4H-1-benzofuran-6-one
3-methyl-5,7-dihydro-4H-1-benzofuran-6-one (PubChem CID 71326738) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 3-methyl-5,7-dihydro-4H-1-benzofuran-6-one.
Molecular Properties
| Compound Name | 3-methyl-5,7-dihydro-4H-1-benzofuran-6-one |
| PubChem CID | 71326738 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 3-methyl-5,7-dihydro-4H-1-benzofuran-6-one |
| SMILES | Cc1coc2c1CCC(=O)C2 |
| InChI | InChI=1S/C9H10O2/c1-6-5-11-9-4-7(10)2-3-8(6)9/h5H,2-4H2,1H3 |
| InChIKey | WUSKTBRXXKPOJJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-5,7-dihydro-4H-1-benzofuran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5,7-dihydro-4H-1-benzofuran-6-one?
The IUPAC name of 3-methyl-5,7-dihydro-4H-1-benzofuran-6-one (CID 71326738) is 3-methyl-5,7-dihydro-4H-1-benzofuran-6-one.
What is the SMILES notation for 3-methyl-5,7-dihydro-4H-1-benzofuran-6-one?
The canonical SMILES for 3-methyl-5,7-dihydro-4H-1-benzofuran-6-one is Cc1coc2c1CCC(=O)C2.
What is the InChIKey of 3-methyl-5,7-dihydro-4H-1-benzofuran-6-one?
The InChIKey is WUSKTBRXXKPOJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-6-5-11-9-4-7(10)2-3-8(6)9/h5H,2-4H2,1H3.
What are the key properties of 3-methyl-5,7-dihydro-4H-1-benzofuran-6-one?
3-methyl-5,7-dihydro-4H-1-benzofuran-6-one has a molecular weight of 150.18 g/mol, XLogP of 1.65, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5,7-dihydro-4H-1-benzofuran-6-one is sourced from PubChem (CID 71326738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).