About trimethyl(3,5,5-trimethylhexoxy)silane
trimethyl(3,5,5-trimethylhexoxy)silane (PubChem CID 71327016) has the molecular formula C12H28OSi
and a molecular weight of 216.44 g/mol. Its IUPAC name is trimethyl(3,5,5-trimethylhexoxy)silane.
Molecular Properties
| Compound Name | trimethyl(3,5,5-trimethylhexoxy)silane |
| PubChem CID | 71327016 |
| Molecular Formula | C12H28OSi |
| Molecular Weight | 216.44 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | trimethyl(3,5,5-trimethylhexoxy)silane |
| SMILES | CC(CCO[Si](C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C12H28OSi/c1-11(10-12(2,3)4)8-9-13-14(5,6)7/h11H,8-10H2,1-7H3 |
| InChIKey | GOZGIOSMYMCXSF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(3,5,5-trimethylhexoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(3,5,5-trimethylhexoxy)silane?
The IUPAC name of trimethyl(3,5,5-trimethylhexoxy)silane (CID 71327016) is trimethyl(3,5,5-trimethylhexoxy)silane.
What is the SMILES notation for trimethyl(3,5,5-trimethylhexoxy)silane?
The canonical SMILES for trimethyl(3,5,5-trimethylhexoxy)silane is CC(CCO[Si](C)(C)C)CC(C)(C)C.
What is the InChIKey of trimethyl(3,5,5-trimethylhexoxy)silane?
The InChIKey is GOZGIOSMYMCXSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28OSi/c1-11(10-12(2,3)4)8-9-13-14(5,6)7/h11H,8-10H2,1-7H3.
What are the key properties of trimethyl(3,5,5-trimethylhexoxy)silane?
trimethyl(3,5,5-trimethylhexoxy)silane has a molecular weight of 216.44 g/mol, XLogP of 4.30, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(3,5,5-trimethylhexoxy)silane is sourced from PubChem (CID 71327016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).