About (Diphenylmethylidene)(2,4,6-trimethylphenyl)-lambda~5~-phosphanone
(Diphenylmethylidene)(2,4,6-trimethylphenyl)-lambda~5~-phosphanone (PubChem CID 71327088) has the molecular formula C22H21OP
and a molecular weight of 332.38 g/mol.
Molecular Properties
| Compound Name | (Diphenylmethylidene)(2,4,6-trimethylphenyl)-lambda~5~-phosphanone |
| PubChem CID | 71327088 |
| Molecular Formula | C22H21OP |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c([P+]([O-])=C(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C22H21OP/c1-16-14-17(2)21(18(3)15-16)24(23)22(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15H,1-3H3 |
| InChIKey | JAFOLXCKUCPDNB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (Diphenylmethylidene)(2,4,6-trimethylphenyl)-lambda~5~-phosphanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Diphenylmethylidene)(2,4,6-trimethylphenyl)-lambda~5~-phosphanone?
The IUPAC name of (Diphenylmethylidene)(2,4,6-trimethylphenyl)-lambda~5~-phosphanone (CID 71327088) is not available.
What is the SMILES notation for (Diphenylmethylidene)(2,4,6-trimethylphenyl)-lambda~5~-phosphanone?
The canonical SMILES for (Diphenylmethylidene)(2,4,6-trimethylphenyl)-lambda~5~-phosphanone is Cc1cc(C)c([P+]([O-])=C(c2ccccc2)c2ccccc2)c(C)c1.
What is the InChIKey of (Diphenylmethylidene)(2,4,6-trimethylphenyl)-lambda~5~-phosphanone?
The InChIKey is JAFOLXCKUCPDNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21OP/c1-16-14-17(2)21(18(3)15-16)24(23)22(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15H,1-3H3.
What are the key properties of (Diphenylmethylidene)(2,4,6-trimethylphenyl)-lambda~5~-phosphanone?
(Diphenylmethylidene)(2,4,6-trimethylphenyl)-lambda~5~-phosphanone has a molecular weight of 332.38 g/mol, XLogP of 4.26, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Diphenylmethylidene)(2,4,6-trimethylphenyl)-lambda~5~-phosphanone is sourced from PubChem (CID 71327088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).