About 8-methyl-5-(2-methyl-1,3-dioxolan-2-yl)non-7-en-2-one
8-methyl-5-(2-methyl-1,3-dioxolan-2-yl)non-7-en-2-one (PubChem CID 71327322) has the molecular formula C14H24O3
and a molecular weight of 240.34 g/mol. Its IUPAC name is 8-methyl-5-(2-methyl-1,3-dioxolan-2-yl)non-7-en-2-one.
Molecular Properties
| Compound Name | 8-methyl-5-(2-methyl-1,3-dioxolan-2-yl)non-7-en-2-one |
| PubChem CID | 71327322 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 8-methyl-5-(2-methyl-1,3-dioxolan-2-yl)non-7-en-2-one |
| SMILES | CC(=O)CCC(CC=C(C)C)C1(C)OCCO1 |
| InChI | InChI=1S/C14H24O3/c1-11(2)5-7-13(8-6-12(3)15)14(4)16-9-10-17-14/h5,13H,6-10H2,1-4H3 |
| InChIKey | JWFHPBZKTCNVDT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-5-(2-methyl-1,3-dioxolan-2-yl)non-7-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-5-(2-methyl-1,3-dioxolan-2-yl)non-7-en-2-one?
The IUPAC name of 8-methyl-5-(2-methyl-1,3-dioxolan-2-yl)non-7-en-2-one (CID 71327322) is 8-methyl-5-(2-methyl-1,3-dioxolan-2-yl)non-7-en-2-one.
What is the SMILES notation for 8-methyl-5-(2-methyl-1,3-dioxolan-2-yl)non-7-en-2-one?
The canonical SMILES for 8-methyl-5-(2-methyl-1,3-dioxolan-2-yl)non-7-en-2-one is CC(=O)CCC(CC=C(C)C)C1(C)OCCO1.
What is the InChIKey of 8-methyl-5-(2-methyl-1,3-dioxolan-2-yl)non-7-en-2-one?
The InChIKey is JWFHPBZKTCNVDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O3/c1-11(2)5-7-13(8-6-12(3)15)14(4)16-9-10-17-14/h5,13H,6-10H2,1-4H3.
What are the key properties of 8-methyl-5-(2-methyl-1,3-dioxolan-2-yl)non-7-en-2-one?
8-methyl-5-(2-methyl-1,3-dioxolan-2-yl)non-7-en-2-one has a molecular weight of 240.34 g/mol, XLogP of 3.09, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-5-(2-methyl-1,3-dioxolan-2-yl)non-7-en-2-one is sourced from PubChem (CID 71327322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).