About anthracen-9-yl-dimethyl-trimethylsilylsilane
anthracen-9-yl-dimethyl-trimethylsilylsilane (PubChem CID 71327443) has the molecular formula C19H24Si2
and a molecular weight of 308.57 g/mol. Its IUPAC name is anthracen-9-yl-dimethyl-trimethylsilylsilane.
Molecular Properties
| Compound Name | anthracen-9-yl-dimethyl-trimethylsilylsilane |
| PubChem CID | 71327443 |
| Molecular Formula | C19H24Si2 |
| Molecular Weight | 308.57 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | anthracen-9-yl-dimethyl-trimethylsilylsilane |
| SMILES | C[Si](C)(C)[Si](C)(C)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C19H24Si2/c1-20(2,3)21(4,5)19-17-12-8-6-10-15(17)14-16-11-7-9-13-18(16)19/h6-14H,1-5H3 |
| InChIKey | FHUHBAOZQYFCRI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracen-9-yl-dimethyl-trimethylsilylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracen-9-yl-dimethyl-trimethylsilylsilane?
The IUPAC name of anthracen-9-yl-dimethyl-trimethylsilylsilane (CID 71327443) is anthracen-9-yl-dimethyl-trimethylsilylsilane.
What is the SMILES notation for anthracen-9-yl-dimethyl-trimethylsilylsilane?
The canonical SMILES for anthracen-9-yl-dimethyl-trimethylsilylsilane is C[Si](C)(C)[Si](C)(C)c1c2ccccc2cc2ccccc12.
What is the InChIKey of anthracen-9-yl-dimethyl-trimethylsilylsilane?
The InChIKey is FHUHBAOZQYFCRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24Si2/c1-20(2,3)21(4,5)19-17-12-8-6-10-15(17)14-16-11-7-9-13-18(16)19/h6-14H,1-5H3.
What are the key properties of anthracen-9-yl-dimethyl-trimethylsilylsilane?
anthracen-9-yl-dimethyl-trimethylsilylsilane has a molecular weight of 308.57 g/mol, XLogP of 5.32, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for anthracen-9-yl-dimethyl-trimethylsilylsilane is sourced from PubChem (CID 71327443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).