C23H44O2 — CID 71327490
4-ethenyl-2,2,4-trimethyl-5-(3,7,11-trimethyldodecyl)-1,3-dioxolane (PubChem CID 71327490) has the molecular formula C23H44O2 and a molecular weight of 352.60 g/mol. Its IUPAC name is 4-ethenyl-2,2,4-trimethyl-5-(3,7,11-trimethyldodecyl)-1,3-dioxolane.
| Compound Name | 4-ethenyl-2,2,4-trimethyl-5-(3,7,11-trimethyldodecyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 71327490 |
| Molecular Formula | C23H44O2 |
| Molecular Weight | 352.60 g/mol |
| Exact Mass | 352.33 |
| IUPAC Name | 4-ethenyl-2,2,4-trimethyl-5-(3,7,11-trimethyldodecyl)-1,3-dioxolane |
| SMILES | C=CC1(C)OC(C)(C)OC1CCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C23H44O2/c1-9-23(8)21(24-22(6,7)25-23)17-16-20(5)15-11-14-19(4)13-10-12-18(2)3/h9,18-21H,1,10-17H2,2-8H3 |
| InChIKey | WFNJLEFEDJFRCY-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.60 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|