C11H11F6N — CID 71327551
2,4,6-trimethyl-3,5-bis(trifluoromethyl)aniline (PubChem CID 71327551) has the molecular formula C11H11F6N and a molecular weight of 271.20 g/mol. Its IUPAC name is 2,4,6-trimethyl-3,5-bis(trifluoromethyl)aniline.
| Compound Name | 2,4,6-trimethyl-3,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 71327551 |
| Molecular Formula | C11H11F6N |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2,4,6-trimethyl-3,5-bis(trifluoromethyl)aniline |
| SMILES | Cc1c(N)c(C)c(C(F)(F)F)c(C)c1C(F)(F)F |
| InChI | InChI=1S/C11H11F6N/c1-4-7(10(12,13)14)5(2)9(18)6(3)8(4)11(15,16)17/h18H2,1-3H3 |
| InChIKey | ZVVAPHHZCGWDPG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|