About 4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane
4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane (PubChem CID 71327742) has the molecular formula C11H20O2S2
and a molecular weight of 248.41 g/mol. Its IUPAC name is 4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane.
Molecular Properties
| Compound Name | 4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane |
| PubChem CID | 71327742 |
| Molecular Formula | C11H20O2S2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane |
| SMILES | CC1(C)OCCC(CC2SCCCS2)O1 |
| InChI | InChI=1S/C11H20O2S2/c1-11(2)12-5-4-9(13-11)8-10-14-6-3-7-15-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | IUWANOTXUMEQDL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane?
The IUPAC name of 4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane (CID 71327742) is 4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane.
What is the SMILES notation for 4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane?
The canonical SMILES for 4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane is CC1(C)OCCC(CC2SCCCS2)O1.
What is the InChIKey of 4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane?
The InChIKey is IUWANOTXUMEQDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2S2/c1-11(2)12-5-4-9(13-11)8-10-14-6-3-7-15-10/h9-10H,3-8H2,1-2H3.
What are the key properties of 4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane?
4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane has a molecular weight of 248.41 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane is sourced from PubChem (CID 71327742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).