About 5-chloro-2,2-dimethyl-1,3-dithiane
5-chloro-2,2-dimethyl-1,3-dithiane (PubChem CID 71327806) has the molecular formula C6H11ClS2
and a molecular weight of 182.74 g/mol. Its IUPAC name is 5-chloro-2,2-dimethyl-1,3-dithiane.
Molecular Properties
| Compound Name | 5-chloro-2,2-dimethyl-1,3-dithiane |
| PubChem CID | 71327806 |
| Molecular Formula | C6H11ClS2 |
| Molecular Weight | 182.74 g/mol |
| Exact Mass | 182.00 |
| IUPAC Name | 5-chloro-2,2-dimethyl-1,3-dithiane |
| SMILES | CC1(C)SCC(Cl)CS1 |
| InChI | InChI=1S/C6H11ClS2/c1-6(2)8-3-5(7)4-9-6/h5H,3-4H2,1-2H3 |
| InChIKey | WKWPFLQVISWURM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.74 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2,2-dimethyl-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,2-dimethyl-1,3-dithiane?
The IUPAC name of 5-chloro-2,2-dimethyl-1,3-dithiane (CID 71327806) is 5-chloro-2,2-dimethyl-1,3-dithiane.
What is the SMILES notation for 5-chloro-2,2-dimethyl-1,3-dithiane?
The canonical SMILES for 5-chloro-2,2-dimethyl-1,3-dithiane is CC1(C)SCC(Cl)CS1.
What is the InChIKey of 5-chloro-2,2-dimethyl-1,3-dithiane?
The InChIKey is WKWPFLQVISWURM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11ClS2/c1-6(2)8-3-5(7)4-9-6/h5H,3-4H2,1-2H3.
What are the key properties of 5-chloro-2,2-dimethyl-1,3-dithiane?
5-chloro-2,2-dimethyl-1,3-dithiane has a molecular weight of 182.74 g/mol, XLogP of 2.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,2-dimethyl-1,3-dithiane is sourced from PubChem (CID 71327806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).