About N-(oxomethylidene)-2-(1,1,2-trifluoropropoxy)benzenesulfonamide
N-(oxomethylidene)-2-(1,1,2-trifluoropropoxy)benzenesulfonamide (PubChem CID 71327878) has the molecular formula C10H8F3NO4S
and a molecular weight of 295.24 g/mol. Its IUPAC name is N-(oxomethylidene)-2-(1,1,2-trifluoropropoxy)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(oxomethylidene)-2-(1,1,2-trifluoropropoxy)benzenesulfonamide |
| PubChem CID | 71327878 |
| Molecular Formula | C10H8F3NO4S |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | N-(oxomethylidene)-2-(1,1,2-trifluoropropoxy)benzenesulfonamide |
| SMILES | CC(F)C(F)(F)Oc1ccccc1S(=O)(=O)N=C=O |
| InChI | InChI=1S/C10H8F3NO4S/c1-7(11)10(12,13)18-8-4-2-3-5-9(8)19(16,17)14-6-15/h2-5,7H,1H3 |
| InChIKey | RGFWJFSLVNYPEP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze N-(oxomethylidene)-2-(1,1,2-trifluoropropoxy)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxomethylidene)-2-(1,1,2-trifluoropropoxy)benzenesulfonamide?
The IUPAC name of N-(oxomethylidene)-2-(1,1,2-trifluoropropoxy)benzenesulfonamide (CID 71327878) is N-(oxomethylidene)-2-(1,1,2-trifluoropropoxy)benzenesulfonamide.
What is the SMILES notation for N-(oxomethylidene)-2-(1,1,2-trifluoropropoxy)benzenesulfonamide?
The canonical SMILES for N-(oxomethylidene)-2-(1,1,2-trifluoropropoxy)benzenesulfonamide is CC(F)C(F)(F)Oc1ccccc1S(=O)(=O)N=C=O.
What is the InChIKey of N-(oxomethylidene)-2-(1,1,2-trifluoropropoxy)benzenesulfonamide?
The InChIKey is RGFWJFSLVNYPEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3NO4S/c1-7(11)10(12,13)18-8-4-2-3-5-9(8)19(16,17)14-6-15/h2-5,7H,1H3.
What are the key properties of N-(oxomethylidene)-2-(1,1,2-trifluoropropoxy)benzenesulfonamide?
N-(oxomethylidene)-2-(1,1,2-trifluoropropoxy)benzenesulfonamide has a molecular weight of 295.24 g/mol, XLogP of 2.04, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxomethylidene)-2-(1,1,2-trifluoropropoxy)benzenesulfonamide is sourced from PubChem (CID 71327878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).