C18H39NO3 — CID 71328174
2-[2-hydroxyethyl(3-undecoxypropyl)amino]ethanol (PubChem CID 71328174) has the molecular formula C18H39NO3 and a molecular weight of 317.51 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(3-undecoxypropyl)amino]ethanol.
| Compound Name | 2-[2-hydroxyethyl(3-undecoxypropyl)amino]ethanol |
|---|---|
| PubChem CID | 71328174 |
| Molecular Formula | C18H39NO3 |
| Molecular Weight | 317.51 g/mol |
| Exact Mass | 317.29 |
| IUPAC Name | 2-[2-hydroxyethyl(3-undecoxypropyl)amino]ethanol |
| SMILES | CCCCCCCCCCCOCCCN(CCO)CCO |
| InChI | InChI=1S/C18H39NO3/c1-2-3-4-5-6-7-8-9-10-17-22-18-11-12-19(13-15-20)14-16-21/h20-21H,2-18H2,1H3 |
| InChIKey | CSXMKXGSWKXVEA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|