About 6-amino-1-methyl-7H-purin-2-one;dihydrate
6-amino-1-methyl-7H-purin-2-one;dihydrate (PubChem CID 71328494) has the molecular formula C6H11N5O3
and a molecular weight of 201.19 g/mol. Its IUPAC name is 6-amino-1-methyl-7H-purin-2-one;dihydrate.
Molecular Properties
| Compound Name | 6-amino-1-methyl-7H-purin-2-one;dihydrate |
| PubChem CID | 71328494 |
| Molecular Formula | C6H11N5O3 |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 6-amino-1-methyl-7H-purin-2-one;dihydrate |
| SMILES | Cn1c(N)c2[nH]cnc2nc1=O.O.O |
| InChI | InChI=1S/C6H7N5O.2H2O/c1-11-4(7)3-5(9-2-8-3)10-6(11)12;;/h2H,7H2,1H3,(H,8,9,10,12);2*1H2 |
| InChIKey | DXTGYJCDPAHWQO-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 152.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-1-methyl-7H-purin-2-one;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1-methyl-7H-purin-2-one;dihydrate?
The IUPAC name of 6-amino-1-methyl-7H-purin-2-one;dihydrate (CID 71328494) is 6-amino-1-methyl-7H-purin-2-one;dihydrate.
What is the SMILES notation for 6-amino-1-methyl-7H-purin-2-one;dihydrate?
The canonical SMILES for 6-amino-1-methyl-7H-purin-2-one;dihydrate is Cn1c(N)c2[nH]cnc2nc1=O.O.O.
What is the InChIKey of 6-amino-1-methyl-7H-purin-2-one;dihydrate?
The InChIKey is DXTGYJCDPAHWQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5O.2H2O/c1-11-4(7)3-5(9-2-8-3)10-6(11)12;;/h2H,7H2,1H3,(H,8,9,10,12);2*1H2.
What are the key properties of 6-amino-1-methyl-7H-purin-2-one;dihydrate?
6-amino-1-methyl-7H-purin-2-one;dihydrate has a molecular weight of 201.19 g/mol, XLogP of -2.41, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1-methyl-7H-purin-2-one;dihydrate is sourced from PubChem (CID 71328494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).