About 9-pent-2-enyl-1,4-dioxaspiro[4.4]non-7-ene
9-pent-2-enyl-1,4-dioxaspiro[4.4]non-7-ene (PubChem CID 71328502) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 9-pent-2-enyl-1,4-dioxaspiro[4.4]non-7-ene.
Molecular Properties
| Compound Name | 9-pent-2-enyl-1,4-dioxaspiro[4.4]non-7-ene |
| PubChem CID | 71328502 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 9-pent-2-enyl-1,4-dioxaspiro[4.4]non-7-ene |
| SMILES | CCC=CCC1C=CCC12OCCO2 |
| InChI | InChI=1S/C12H18O2/c1-2-3-4-6-11-7-5-8-12(11)13-9-10-14-12/h3-5,7,11H,2,6,8-10H2,1H3 |
| InChIKey | NAMMWDYLZXOVBJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-pent-2-enyl-1,4-dioxaspiro[4.4]non-7-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-pent-2-enyl-1,4-dioxaspiro[4.4]non-7-ene?
The IUPAC name of 9-pent-2-enyl-1,4-dioxaspiro[4.4]non-7-ene (CID 71328502) is 9-pent-2-enyl-1,4-dioxaspiro[4.4]non-7-ene.
What is the SMILES notation for 9-pent-2-enyl-1,4-dioxaspiro[4.4]non-7-ene?
The canonical SMILES for 9-pent-2-enyl-1,4-dioxaspiro[4.4]non-7-ene is CCC=CCC1C=CCC12OCCO2.
What is the InChIKey of 9-pent-2-enyl-1,4-dioxaspiro[4.4]non-7-ene?
The InChIKey is NAMMWDYLZXOVBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-2-3-4-6-11-7-5-8-12(11)13-9-10-14-12/h3-5,7,11H,2,6,8-10H2,1H3.
What are the key properties of 9-pent-2-enyl-1,4-dioxaspiro[4.4]non-7-ene?
9-pent-2-enyl-1,4-dioxaspiro[4.4]non-7-ene has a molecular weight of 194.27 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-pent-2-enyl-1,4-dioxaspiro[4.4]non-7-ene is sourced from PubChem (CID 71328502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).