About butyl 3-(1,3-oxazolidin-3-yl)propanoate
butyl 3-(1,3-oxazolidin-3-yl)propanoate (PubChem CID 71328697) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is butyl 3-(1,3-oxazolidin-3-yl)propanoate.
Molecular Properties
| Compound Name | butyl 3-(1,3-oxazolidin-3-yl)propanoate |
| PubChem CID | 71328697 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | butyl 3-(1,3-oxazolidin-3-yl)propanoate |
| SMILES | CCCCOC(=O)CCN1CCOC1 |
| InChI | InChI=1S/C10H19NO3/c1-2-3-7-14-10(12)4-5-11-6-8-13-9-11/h2-9H2,1H3 |
| InChIKey | LYKCPLQPWJBJLH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 3-(1,3-oxazolidin-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 3-(1,3-oxazolidin-3-yl)propanoate?
The IUPAC name of butyl 3-(1,3-oxazolidin-3-yl)propanoate (CID 71328697) is butyl 3-(1,3-oxazolidin-3-yl)propanoate.
What is the SMILES notation for butyl 3-(1,3-oxazolidin-3-yl)propanoate?
The canonical SMILES for butyl 3-(1,3-oxazolidin-3-yl)propanoate is CCCCOC(=O)CCN1CCOC1.
What is the InChIKey of butyl 3-(1,3-oxazolidin-3-yl)propanoate?
The InChIKey is LYKCPLQPWJBJLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-2-3-7-14-10(12)4-5-11-6-8-13-9-11/h2-9H2,1H3.
What are the key properties of butyl 3-(1,3-oxazolidin-3-yl)propanoate?
butyl 3-(1,3-oxazolidin-3-yl)propanoate has a molecular weight of 201.27 g/mol, XLogP of 1.01, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 3-(1,3-oxazolidin-3-yl)propanoate is sourced from PubChem (CID 71328697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).