About 2-chloro-5-(2-methyl-1,3-dioxolan-2-yl)phenol
2-chloro-5-(2-methyl-1,3-dioxolan-2-yl)phenol (PubChem CID 71328780) has the molecular formula C10H11ClO3
and a molecular weight of 214.65 g/mol. Its IUPAC name is 2-chloro-5-(2-methyl-1,3-dioxolan-2-yl)phenol.
Molecular Properties
| Compound Name | 2-chloro-5-(2-methyl-1,3-dioxolan-2-yl)phenol |
| PubChem CID | 71328780 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 2-chloro-5-(2-methyl-1,3-dioxolan-2-yl)phenol |
| SMILES | CC1(c2ccc(Cl)c(O)c2)OCCO1 |
| InChI | InChI=1S/C10H11ClO3/c1-10(13-4-5-14-10)7-2-3-8(11)9(12)6-7/h2-3,6,12H,4-5H2,1H3 |
| InChIKey | IRIFICVAFVJRHQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-5-(2-methyl-1,3-dioxolan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(2-methyl-1,3-dioxolan-2-yl)phenol?
The IUPAC name of 2-chloro-5-(2-methyl-1,3-dioxolan-2-yl)phenol (CID 71328780) is 2-chloro-5-(2-methyl-1,3-dioxolan-2-yl)phenol.
What is the SMILES notation for 2-chloro-5-(2-methyl-1,3-dioxolan-2-yl)phenol?
The canonical SMILES for 2-chloro-5-(2-methyl-1,3-dioxolan-2-yl)phenol is CC1(c2ccc(Cl)c(O)c2)OCCO1.
What is the InChIKey of 2-chloro-5-(2-methyl-1,3-dioxolan-2-yl)phenol?
The InChIKey is IRIFICVAFVJRHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO3/c1-10(13-4-5-14-10)7-2-3-8(11)9(12)6-7/h2-3,6,12H,4-5H2,1H3.
What are the key properties of 2-chloro-5-(2-methyl-1,3-dioxolan-2-yl)phenol?
2-chloro-5-(2-methyl-1,3-dioxolan-2-yl)phenol has a molecular weight of 214.65 g/mol, XLogP of 2.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(2-methyl-1,3-dioxolan-2-yl)phenol is sourced from PubChem (CID 71328780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).