About 8-nitropyrido[2,1-b]quinazolin-11-one
8-nitropyrido[2,1-b]quinazolin-11-one (PubChem CID 71329099) has the molecular formula C12H7N3O3
and a molecular weight of 241.21 g/mol. Its IUPAC name is 8-nitropyrido[2,1-b]quinazolin-11-one.
Molecular Properties
| Compound Name | 8-nitropyrido[2,1-b]quinazolin-11-one |
| PubChem CID | 71329099 |
| Molecular Formula | C12H7N3O3 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 8-nitropyrido[2,1-b]quinazolin-11-one |
| SMILES | O=c1c2ccccc2nc2ccc([N+](=O)[O-])cn12 |
| InChI | InChI=1S/C12H7N3O3/c16-12-9-3-1-2-4-10(9)13-11-6-5-8(15(17)18)7-14(11)12/h1-7H |
| InChIKey | JNVDIXKWKZRTOW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 8-nitropyrido[2,1-b]quinazolin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-nitropyrido[2,1-b]quinazolin-11-one?
The IUPAC name of 8-nitropyrido[2,1-b]quinazolin-11-one (CID 71329099) is 8-nitropyrido[2,1-b]quinazolin-11-one.
What is the SMILES notation for 8-nitropyrido[2,1-b]quinazolin-11-one?
The canonical SMILES for 8-nitropyrido[2,1-b]quinazolin-11-one is O=c1c2ccccc2nc2ccc([N+](=O)[O-])cn12.
What is the InChIKey of 8-nitropyrido[2,1-b]quinazolin-11-one?
The InChIKey is JNVDIXKWKZRTOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3O3/c16-12-9-3-1-2-4-10(9)13-11-6-5-8(15(17)18)7-14(11)12/h1-7H.
What are the key properties of 8-nitropyrido[2,1-b]quinazolin-11-one?
8-nitropyrido[2,1-b]quinazolin-11-one has a molecular weight of 241.21 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-nitropyrido[2,1-b]quinazolin-11-one is sourced from PubChem (CID 71329099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).