C12H12F12 — CID 71329208
1,1,1,2,2,3,3,4,4,5,5,6-dodecafluorododec-6-ene (PubChem CID 71329208) has the molecular formula C12H12F12 and a molecular weight of 384.20 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6-dodecafluorododec-6-ene.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6-dodecafluorododec-6-ene |
|---|---|
| PubChem CID | 71329208 |
| Molecular Formula | C12H12F12 |
| Molecular Weight | 384.20 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6-dodecafluorododec-6-ene |
| SMILES | CCCCCC=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H12F12/c1-2-3-4-5-6-7(13)8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)24/h6H,2-5H2,1H3 |
| InChIKey | QSMWTZRYLVVETD-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.20 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|