About [tert-butyl(dimethyl)silyl] 4-methyl-2-oxopentanoate
[tert-butyl(dimethyl)silyl] 4-methyl-2-oxopentanoate (PubChem CID 71329341) has the molecular formula C12H24O3Si
and a molecular weight of 244.41 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 4-methyl-2-oxopentanoate.
Molecular Properties
| Compound Name | [tert-butyl(dimethyl)silyl] 4-methyl-2-oxopentanoate |
| PubChem CID | 71329341 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 4-methyl-2-oxopentanoate |
| SMILES | CC(C)CC(=O)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24O3Si/c1-9(2)8-10(13)11(14)15-16(6,7)12(3,4)5/h9H,8H2,1-7H3 |
| InChIKey | GSHJQXMVPVYUMP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [tert-butyl(dimethyl)silyl] 4-methyl-2-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tert-butyl(dimethyl)silyl] 4-methyl-2-oxopentanoate?
The IUPAC name of [tert-butyl(dimethyl)silyl] 4-methyl-2-oxopentanoate (CID 71329341) is [tert-butyl(dimethyl)silyl] 4-methyl-2-oxopentanoate.
What is the SMILES notation for [tert-butyl(dimethyl)silyl] 4-methyl-2-oxopentanoate?
The canonical SMILES for [tert-butyl(dimethyl)silyl] 4-methyl-2-oxopentanoate is CC(C)CC(=O)C(=O)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [tert-butyl(dimethyl)silyl] 4-methyl-2-oxopentanoate?
The InChIKey is GSHJQXMVPVYUMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3Si/c1-9(2)8-10(13)11(14)15-16(6,7)12(3,4)5/h9H,8H2,1-7H3.
What are the key properties of [tert-butyl(dimethyl)silyl] 4-methyl-2-oxopentanoate?
[tert-butyl(dimethyl)silyl] 4-methyl-2-oxopentanoate has a molecular weight of 244.41 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [tert-butyl(dimethyl)silyl] 4-methyl-2-oxopentanoate is sourced from PubChem (CID 71329341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).