About 2-ethylhexan-1-ol;methanesulfonic acid
2-ethylhexan-1-ol;methanesulfonic acid (PubChem CID 71329451) has the molecular formula C9H22O4S
and a molecular weight of 226.34 g/mol. Its IUPAC name is 2-ethylhexan-1-ol;methanesulfonic acid.
Molecular Properties
| Compound Name | 2-ethylhexan-1-ol;methanesulfonic acid |
| PubChem CID | 71329451 |
| Molecular Formula | C9H22O4S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-ethylhexan-1-ol;methanesulfonic acid |
| SMILES | CCCCC(CC)CO.CS(=O)(=O)O |
| InChI | InChI=1S/C8H18O.CH4O3S/c1-3-5-6-8(4-2)7-9;1-5(2,3)4/h8-9H,3-7H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | GPSSMHUDCHCGAP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexan-1-ol;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexan-1-ol;methanesulfonic acid?
The IUPAC name of 2-ethylhexan-1-ol;methanesulfonic acid (CID 71329451) is 2-ethylhexan-1-ol;methanesulfonic acid.
What is the SMILES notation for 2-ethylhexan-1-ol;methanesulfonic acid?
The canonical SMILES for 2-ethylhexan-1-ol;methanesulfonic acid is CCCCC(CC)CO.CS(=O)(=O)O.
What is the InChIKey of 2-ethylhexan-1-ol;methanesulfonic acid?
The InChIKey is GPSSMHUDCHCGAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.CH4O3S/c1-3-5-6-8(4-2)7-9;1-5(2,3)4/h8-9H,3-7H2,1-2H3;1H3,(H,2,3,4).
What are the key properties of 2-ethylhexan-1-ol;methanesulfonic acid?
2-ethylhexan-1-ol;methanesulfonic acid has a molecular weight of 226.34 g/mol, XLogP of 1.70, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexan-1-ol;methanesulfonic acid is sourced from PubChem (CID 71329451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).