C17H20O3P2 — CID 71329899
4,4-dimethyl-2,6-diphenyl-1,2λ5,6λ5-oxadiphosphinane 2,6-dioxide (PubChem CID 71329899) has the molecular formula C17H20O3P2 and a molecular weight of 334.29 g/mol. Its IUPAC name is 4,4-dimethyl-2,6-diphenyl-1,2λ5,6λ5-oxadiphosphinane 2,6-dioxide.
| Compound Name | 4,4-dimethyl-2,6-diphenyl-1,2λ5,6λ5-oxadiphosphinane 2,6-dioxide |
|---|---|
| PubChem CID | 71329899 |
| Molecular Formula | C17H20O3P2 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 4,4-dimethyl-2,6-diphenyl-1,2λ5,6λ5-oxadiphosphinane 2,6-dioxide |
| SMILES | CC1(C)CP(=O)(c2ccccc2)OP(=O)(c2ccccc2)C1 |
| InChI | InChI=1S/C17H20O3P2/c1-17(2)13-21(18,15-9-5-3-6-10-15)20-22(19,14-17)16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3 |
| InChIKey | GRHMWCCQUZNHEZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|