About 4-methylphenol;piperazine
4-methylphenol;piperazine (PubChem CID 71330190) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-methylphenol;piperazine.
Molecular Properties
| Compound Name | 4-methylphenol;piperazine |
| PubChem CID | 71330190 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 4-methylphenol;piperazine |
| SMILES | C1CNCCN1.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O.C4H10N2/c1-6-2-4-7(8)5-3-6;1-2-6-4-3-5-1/h2-5,8H,1H3;5-6H,1-4H2 |
| InChIKey | WZHOJHMMEFBAMB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylphenol;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylphenol;piperazine?
The IUPAC name of 4-methylphenol;piperazine (CID 71330190) is 4-methylphenol;piperazine.
What is the SMILES notation for 4-methylphenol;piperazine?
The canonical SMILES for 4-methylphenol;piperazine is C1CNCCN1.Cc1ccc(O)cc1.
What is the InChIKey of 4-methylphenol;piperazine?
The InChIKey is WZHOJHMMEFBAMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C4H10N2/c1-6-2-4-7(8)5-3-6;1-2-6-4-3-5-1/h2-5,8H,1H3;5-6H,1-4H2.
What are the key properties of 4-methylphenol;piperazine?
4-methylphenol;piperazine has a molecular weight of 194.28 g/mol, XLogP of 0.88, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylphenol;piperazine is sourced from PubChem (CID 71330190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).