About 5-chloro-2,2-dimethyl-N-(oxomethylidene)-3H-1-benzofuran-7-sulfonamide
5-chloro-2,2-dimethyl-N-(oxomethylidene)-3H-1-benzofuran-7-sulfonamide (PubChem CID 71330591) has the molecular formula C11H10ClNO4S
and a molecular weight of 287.72 g/mol. Its IUPAC name is 5-chloro-2,2-dimethyl-N-(oxomethylidene)-3H-1-benzofuran-7-sulfonamide.
Molecular Properties
| Compound Name | 5-chloro-2,2-dimethyl-N-(oxomethylidene)-3H-1-benzofuran-7-sulfonamide |
| PubChem CID | 71330591 |
| Molecular Formula | C11H10ClNO4S |
| Molecular Weight | 287.72 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 5-chloro-2,2-dimethyl-N-(oxomethylidene)-3H-1-benzofuran-7-sulfonamide |
| SMILES | CC1(C)Cc2cc(Cl)cc(S(=O)(=O)N=C=O)c2O1 |
| InChI | InChI=1S/C11H10ClNO4S/c1-11(2)5-7-3-8(12)4-9(10(7)17-11)18(15,16)13-6-14/h3-4H,5H2,1-2H3 |
| InChIKey | PZWUTECLIGBGQO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.72 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2,2-dimethyl-N-(oxomethylidene)-3H-1-benzofuran-7-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,2-dimethyl-N-(oxomethylidene)-3H-1-benzofuran-7-sulfonamide?
The IUPAC name of 5-chloro-2,2-dimethyl-N-(oxomethylidene)-3H-1-benzofuran-7-sulfonamide (CID 71330591) is 5-chloro-2,2-dimethyl-N-(oxomethylidene)-3H-1-benzofuran-7-sulfonamide.
What is the SMILES notation for 5-chloro-2,2-dimethyl-N-(oxomethylidene)-3H-1-benzofuran-7-sulfonamide?
The canonical SMILES for 5-chloro-2,2-dimethyl-N-(oxomethylidene)-3H-1-benzofuran-7-sulfonamide is CC1(C)Cc2cc(Cl)cc(S(=O)(=O)N=C=O)c2O1.
What is the InChIKey of 5-chloro-2,2-dimethyl-N-(oxomethylidene)-3H-1-benzofuran-7-sulfonamide?
The InChIKey is PZWUTECLIGBGQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO4S/c1-11(2)5-7-3-8(12)4-9(10(7)17-11)18(15,16)13-6-14/h3-4H,5H2,1-2H3.
What are the key properties of 5-chloro-2,2-dimethyl-N-(oxomethylidene)-3H-1-benzofuran-7-sulfonamide?
5-chloro-2,2-dimethyl-N-(oxomethylidene)-3H-1-benzofuran-7-sulfonamide has a molecular weight of 287.72 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,2-dimethyl-N-(oxomethylidene)-3H-1-benzofuran-7-sulfonamide is sourced from PubChem (CID 71330591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).