About 1-methyl-2,6-dihydropyridin-3-one;hydrochloride
1-methyl-2,6-dihydropyridin-3-one;hydrochloride (PubChem CID 71330640) has the molecular formula C6H10ClNO
and a molecular weight of 147.61 g/mol. Its IUPAC name is 1-methyl-2,6-dihydropyridin-3-one;hydrochloride.
Molecular Properties
| Compound Name | 1-methyl-2,6-dihydropyridin-3-one;hydrochloride |
| PubChem CID | 71330640 |
| Molecular Formula | C6H10ClNO |
| Molecular Weight | 147.61 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 1-methyl-2,6-dihydropyridin-3-one;hydrochloride |
| SMILES | CN1CC=CC(=O)C1.Cl |
| InChI | InChI=1S/C6H9NO.ClH/c1-7-4-2-3-6(8)5-7;/h2-3H,4-5H2,1H3;1H |
| InChIKey | DUEGMRNKWWFVET-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.61 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-2,6-dihydropyridin-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,6-dihydropyridin-3-one;hydrochloride?
The IUPAC name of 1-methyl-2,6-dihydropyridin-3-one;hydrochloride (CID 71330640) is 1-methyl-2,6-dihydropyridin-3-one;hydrochloride.
What is the SMILES notation for 1-methyl-2,6-dihydropyridin-3-one;hydrochloride?
The canonical SMILES for 1-methyl-2,6-dihydropyridin-3-one;hydrochloride is CN1CC=CC(=O)C1.Cl.
What is the InChIKey of 1-methyl-2,6-dihydropyridin-3-one;hydrochloride?
The InChIKey is DUEGMRNKWWFVET-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.ClH/c1-7-4-2-3-6(8)5-7;/h2-3H,4-5H2,1H3;1H.
What are the key properties of 1-methyl-2,6-dihydropyridin-3-one;hydrochloride?
1-methyl-2,6-dihydropyridin-3-one;hydrochloride has a molecular weight of 147.61 g/mol, XLogP of 0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,6-dihydropyridin-3-one;hydrochloride is sourced from PubChem (CID 71330640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).