C11H14O4 — CID 71330691
dimethyl 2-buta-1,3-dienylcyclopropane-1,1-dicarboxylate (PubChem CID 71330691) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is dimethyl 2-buta-1,3-dienylcyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-buta-1,3-dienylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 71330691 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | dimethyl 2-buta-1,3-dienylcyclopropane-1,1-dicarboxylate |
| SMILES | C=CC=CC1CC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C11H14O4/c1-4-5-6-8-7-11(8,9(12)14-2)10(13)15-3/h4-6,8H,1,7H2,2-3H3 |
| InChIKey | CVSJBQYWKIOWPU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|