About [5-[[5-(hydroxymethyl)-1,3-dioxan-5-yl]methoxymethyl]-1,3-dioxan-5-yl]methanol
[5-[[5-(hydroxymethyl)-1,3-dioxan-5-yl]methoxymethyl]-1,3-dioxan-5-yl]methanol (PubChem CID 71330777) has the molecular formula C12H22O7
and a molecular weight of 278.30 g/mol. Its IUPAC name is [5-[[5-(hydroxymethyl)-1,3-dioxan-5-yl]methoxymethyl]-1,3-dioxan-5-yl]methanol.
Molecular Properties
| Compound Name | [5-[[5-(hydroxymethyl)-1,3-dioxan-5-yl]methoxymethyl]-1,3-dioxan-5-yl]methanol |
| PubChem CID | 71330777 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | [5-[[5-(hydroxymethyl)-1,3-dioxan-5-yl]methoxymethyl]-1,3-dioxan-5-yl]methanol |
| SMILES | OCC1(COCC2(CO)COCOC2)COCOC1 |
| InChI | InChI=1S/C12H22O7/c13-1-11(5-16-9-17-6-11)3-15-4-12(2-14)7-18-10-19-8-12/h13-14H,1-10H2 |
| InChIKey | OJDFAAXXBZSNLT-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [5-[[5-(hydroxymethyl)-1,3-dioxan-5-yl]methoxymethyl]-1,3-dioxan-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[[5-(hydroxymethyl)-1,3-dioxan-5-yl]methoxymethyl]-1,3-dioxan-5-yl]methanol?
The IUPAC name of [5-[[5-(hydroxymethyl)-1,3-dioxan-5-yl]methoxymethyl]-1,3-dioxan-5-yl]methanol (CID 71330777) is [5-[[5-(hydroxymethyl)-1,3-dioxan-5-yl]methoxymethyl]-1,3-dioxan-5-yl]methanol.
What is the SMILES notation for [5-[[5-(hydroxymethyl)-1,3-dioxan-5-yl]methoxymethyl]-1,3-dioxan-5-yl]methanol?
The canonical SMILES for [5-[[5-(hydroxymethyl)-1,3-dioxan-5-yl]methoxymethyl]-1,3-dioxan-5-yl]methanol is OCC1(COCC2(CO)COCOC2)COCOC1.
What is the InChIKey of [5-[[5-(hydroxymethyl)-1,3-dioxan-5-yl]methoxymethyl]-1,3-dioxan-5-yl]methanol?
The InChIKey is OJDFAAXXBZSNLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O7/c13-1-11(5-16-9-17-6-11)3-15-4-12(2-14)7-18-10-19-8-12/h13-14H,1-10H2.
What are the key properties of [5-[[5-(hydroxymethyl)-1,3-dioxan-5-yl]methoxymethyl]-1,3-dioxan-5-yl]methanol?
[5-[[5-(hydroxymethyl)-1,3-dioxan-5-yl]methoxymethyl]-1,3-dioxan-5-yl]methanol has a molecular weight of 278.30 g/mol, XLogP of -1.03, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[[5-(hydroxymethyl)-1,3-dioxan-5-yl]methoxymethyl]-1,3-dioxan-5-yl]methanol is sourced from PubChem (CID 71330777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).