About quinolin-8-yl piperidine-1-carboxylate
quinolin-8-yl piperidine-1-carboxylate (PubChem CID 713309) has the molecular formula C15H16N2O2
and a molecular weight of 256.31 g/mol. Its IUPAC name is quinolin-8-yl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | quinolin-8-yl piperidine-1-carboxylate |
| PubChem CID | 713309 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | quinolin-8-yl piperidine-1-carboxylate |
| SMILES | O=C(Oc1cccc2cccnc12)N1CCCCC1 |
| InChI | InChI=1S/C15H16N2O2/c18-15(17-10-2-1-3-11-17)19-13-8-4-6-12-7-5-9-16-14(12)13/h4-9H,1-3,10-11H2 |
| InChIKey | NMAHWWYZVAQAMR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze quinolin-8-yl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-8-yl piperidine-1-carboxylate?
The IUPAC name of quinolin-8-yl piperidine-1-carboxylate (CID 713309) is quinolin-8-yl piperidine-1-carboxylate.
What is the SMILES notation for quinolin-8-yl piperidine-1-carboxylate?
The canonical SMILES for quinolin-8-yl piperidine-1-carboxylate is O=C(Oc1cccc2cccnc12)N1CCCCC1.
What is the InChIKey of quinolin-8-yl piperidine-1-carboxylate?
The InChIKey is NMAHWWYZVAQAMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2/c18-15(17-10-2-1-3-11-17)19-13-8-4-6-12-7-5-9-16-14(12)13/h4-9H,1-3,10-11H2.
What are the key properties of quinolin-8-yl piperidine-1-carboxylate?
quinolin-8-yl piperidine-1-carboxylate has a molecular weight of 256.31 g/mol, XLogP of 3.22, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-8-yl piperidine-1-carboxylate is sourced from PubChem (CID 713309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).