C16H22O4 — CID 71331267
3,5,6-trihydroxy-4,6-bis(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one (PubChem CID 71331267) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 3,5,6-trihydroxy-4,6-bis(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 3,5,6-trihydroxy-4,6-bis(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 71331267 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 3,5,6-trihydroxy-4,6-bis(3-methylbut-2-enyl)cyclohexa-2,4-dien-1-one |
| SMILES | CC(C)=CCC1=C(O)C(O)(CC=C(C)C)C(=O)C=C1O |
| InChI | InChI=1S/C16H22O4/c1-10(2)5-6-12-13(17)9-14(18)16(20,15(12)19)8-7-11(3)4/h5,7,9,17,19-20H,6,8H2,1-4H3 |
| InChIKey | OGDZLCNXLZYCOA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|