About 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol bromide
2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol bromide (PubChem CID 71331688) has the molecular formula C6H13BrN2O
and a molecular weight of 209.09 g/mol. Its IUPAC name is 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol bromide.
Molecular Properties
| Compound Name | 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol bromide |
| PubChem CID | 71331688 |
| Molecular Formula | C6H13BrN2O |
| Molecular Weight | 209.09 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol bromide |
| SMILES | CN1C=C[NH+](CCO)C1.[Br-] |
| InChI | InChI=1S/C6H12N2O.BrH/c1-7-2-3-8(6-7)4-5-9;/h2-3,9H,4-6H2,1H3;1H |
| InChIKey | FMMGYCUEIGIEOV-UHFFFAOYSA-N |
| XLogP | -4.76 |
| TPSA | 27.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.09 |
| LogP ≤ 5 | -4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol bromide?
The IUPAC name of 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol bromide (CID 71331688) is 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol bromide.
What is the SMILES notation for 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol bromide?
The canonical SMILES for 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol bromide is CN1C=C[NH+](CCO)C1.[Br-].
What is the InChIKey of 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol bromide?
The InChIKey is FMMGYCUEIGIEOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.BrH/c1-7-2-3-8(6-7)4-5-9;/h2-3,9H,4-6H2,1H3;1H.
What are the key properties of 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol bromide?
2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol bromide has a molecular weight of 209.09 g/mol, XLogP of -4.76, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol bromide is sourced from PubChem (CID 71331688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).