C4H2F6INO2 — CID 71331963
2,2-difluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)acetamide (PubChem CID 71331963) has the molecular formula C4H2F6INO2 and a molecular weight of 336.96 g/mol. Its IUPAC name is 2,2-difluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)acetamide.
| Compound Name | 2,2-difluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)acetamide |
|---|---|
| PubChem CID | 71331963 |
| Molecular Formula | C4H2F6INO2 |
| Molecular Weight | 336.96 g/mol |
| Exact Mass | 336.90 |
| IUPAC Name | 2,2-difluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)acetamide |
| SMILES | NC(=O)C(F)(F)OC(F)(F)C(F)(F)I |
| InChI | InChI=1S/C4H2F6INO2/c5-2(6,1(12)13)14-4(9,10)3(7,8)11/h(H2,12,13) |
| InChIKey | KMQXXRJUVPBBNZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.96 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|