About decan-1-amine;decylcarbamodithioic acid
decan-1-amine;decylcarbamodithioic acid (PubChem CID 71332408) has the molecular formula C21H46N2S2
and a molecular weight of 390.75 g/mol. Its IUPAC name is decan-1-amine;decylcarbamodithioic acid.
Molecular Properties
| Compound Name | decan-1-amine;decylcarbamodithioic acid |
| PubChem CID | 71332408 |
| Molecular Formula | C21H46N2S2 |
| Molecular Weight | 390.75 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | decan-1-amine;decylcarbamodithioic acid |
| SMILES | CCCCCCCCCCN.CCCCCCCCCCNC(=S)S |
| InChI | InChI=1S/C11H23NS2.C10H23N/c1-2-3-4-5-6-7-8-9-10-12-11(13)14;1-2-3-4-5-6-7-8-9-10-11/h2-10H2,1H3,(H2,12,13,14);2-11H2,1H3 |
| InChIKey | KRQARHXNUDORQK-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.75 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze decan-1-amine;decylcarbamodithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-1-amine;decylcarbamodithioic acid?
The IUPAC name of decan-1-amine;decylcarbamodithioic acid (CID 71332408) is decan-1-amine;decylcarbamodithioic acid.
What is the SMILES notation for decan-1-amine;decylcarbamodithioic acid?
The canonical SMILES for decan-1-amine;decylcarbamodithioic acid is CCCCCCCCCCN.CCCCCCCCCCNC(=S)S.
What is the InChIKey of decan-1-amine;decylcarbamodithioic acid?
The InChIKey is KRQARHXNUDORQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NS2.C10H23N/c1-2-3-4-5-6-7-8-9-10-12-11(13)14;1-2-3-4-5-6-7-8-9-10-11/h2-10H2,1H3,(H2,12,13,14);2-11H2,1H3.
What are the key properties of decan-1-amine;decylcarbamodithioic acid?
decan-1-amine;decylcarbamodithioic acid has a molecular weight of 390.75 g/mol, XLogP of 7.02, 17 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decan-1-amine;decylcarbamodithioic acid is sourced from PubChem (CID 71332408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).