About 2-(2,4-dipentylphenoxy)-N,N-diethylacetamide
2-(2,4-dipentylphenoxy)-N,N-diethylacetamide (PubChem CID 71332513) has the molecular formula C22H37NO2
and a molecular weight of 347.54 g/mol. Its IUPAC name is 2-(2,4-dipentylphenoxy)-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-(2,4-dipentylphenoxy)-N,N-diethylacetamide |
| PubChem CID | 71332513 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | 2-(2,4-dipentylphenoxy)-N,N-diethylacetamide |
| SMILES | CCCCCc1ccc(OCC(=O)N(CC)CC)c(CCCCC)c1 |
| InChI | InChI=1S/C22H37NO2/c1-5-9-11-13-19-15-16-21(20(17-19)14-12-10-6-2)25-18-22(24)23(7-3)8-4/h15-17H,5-14,18H2,1-4H3 |
| InChIKey | JAEANXPMQQXRDH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dipentylphenoxy)-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dipentylphenoxy)-N,N-diethylacetamide?
The IUPAC name of 2-(2,4-dipentylphenoxy)-N,N-diethylacetamide (CID 71332513) is 2-(2,4-dipentylphenoxy)-N,N-diethylacetamide.
What is the SMILES notation for 2-(2,4-dipentylphenoxy)-N,N-diethylacetamide?
The canonical SMILES for 2-(2,4-dipentylphenoxy)-N,N-diethylacetamide is CCCCCc1ccc(OCC(=O)N(CC)CC)c(CCCCC)c1.
What is the InChIKey of 2-(2,4-dipentylphenoxy)-N,N-diethylacetamide?
The InChIKey is JAEANXPMQQXRDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H37NO2/c1-5-9-11-13-19-15-16-21(20(17-19)14-12-10-6-2)25-18-22(24)23(7-3)8-4/h15-17H,5-14,18H2,1-4H3.
What are the key properties of 2-(2,4-dipentylphenoxy)-N,N-diethylacetamide?
2-(2,4-dipentylphenoxy)-N,N-diethylacetamide has a molecular weight of 347.54 g/mol, XLogP of 5.40, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dipentylphenoxy)-N,N-diethylacetamide is sourced from PubChem (CID 71332513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).