About dichloro(silyl)silane
dichloro(silyl)silane (PubChem CID 71332635) has the molecular formula H4Cl2Si2
and a molecular weight of 131.11 g/mol. Its IUPAC name is dichloro(silyl)silane.
Molecular Properties
| Compound Name | dichloro(silyl)silane |
| PubChem CID | 71332635 |
| Molecular Formula | H4Cl2Si2 |
| Molecular Weight | 131.11 g/mol |
| Exact Mass | 129.92 |
| IUPAC Name | dichloro(silyl)silane |
| SMILES | [SiH3][SiH](Cl)Cl |
| InChI | InChI=1S/Cl2H4Si2/c1-4(2)3/h4H,3H3 |
| InChIKey | FXOCTISBMXDWGP-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.11 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dichloro(silyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(silyl)silane?
The IUPAC name of dichloro(silyl)silane (CID 71332635) is dichloro(silyl)silane.
What is the SMILES notation for dichloro(silyl)silane?
The canonical SMILES for dichloro(silyl)silane is [SiH3][SiH](Cl)Cl.
What is the InChIKey of dichloro(silyl)silane?
The InChIKey is FXOCTISBMXDWGP-UHFFFAOYSA-N. The full InChI is InChI=1S/Cl2H4Si2/c1-4(2)3/h4H,3H3.
What are the key properties of dichloro(silyl)silane?
dichloro(silyl)silane has a molecular weight of 131.11 g/mol, XLogP of -0.45, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(silyl)silane is sourced from PubChem (CID 71332635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).