C22H24 — CID 71332867
2,2,17,17-tetramethyloctadeca-5,9,13-trien-3,7,11,15-tetrayne (PubChem CID 71332867) has the molecular formula C22H24 and a molecular weight of 288.43 g/mol. Its IUPAC name is 2,2,17,17-tetramethyloctadeca-5,9,13-trien-3,7,11,15-tetrayne.
| Compound Name | 2,2,17,17-tetramethyloctadeca-5,9,13-trien-3,7,11,15-tetrayne |
|---|---|
| PubChem CID | 71332867 |
| Molecular Formula | C22H24 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 2,2,17,17-tetramethyloctadeca-5,9,13-trien-3,7,11,15-tetrayne |
| SMILES | CC(C)(C)C#CC=CC#CC=CC#CC=CC#CC(C)(C)C |
| InChI | InChI=1S/C22H24/c1-21(2,3)19-17-15-13-11-9-7-8-10-12-14-16-18-20-22(4,5)6/h7-8,13-16H,1-6H3 |
| InChIKey | PTPSIMYQDPDUHJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|