About 2-(3,4-dimethoxyphenyl)-2-pent-4-enyl-1,3-dithiane
2-(3,4-dimethoxyphenyl)-2-pent-4-enyl-1,3-dithiane (PubChem CID 71333117) has the molecular formula C17H24O2S2
and a molecular weight of 324.51 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-2-pent-4-enyl-1,3-dithiane.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-2-pent-4-enyl-1,3-dithiane |
| PubChem CID | 71333117 |
| Molecular Formula | C17H24O2S2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-2-pent-4-enyl-1,3-dithiane |
| SMILES | C=CCCCC1(c2ccc(OC)c(OC)c2)SCCCS1 |
| InChI | InChI=1S/C17H24O2S2/c1-4-5-6-10-17(20-11-7-12-21-17)14-8-9-15(18-2)16(13-14)19-3/h4,8-9,13H,1,5-7,10-12H2,2-3H3 |
| InChIKey | GISVTXCBFGZALC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dimethoxyphenyl)-2-pent-4-enyl-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-2-pent-4-enyl-1,3-dithiane?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-2-pent-4-enyl-1,3-dithiane (CID 71333117) is 2-(3,4-dimethoxyphenyl)-2-pent-4-enyl-1,3-dithiane.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-2-pent-4-enyl-1,3-dithiane?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-2-pent-4-enyl-1,3-dithiane is C=CCCCC1(c2ccc(OC)c(OC)c2)SCCCS1.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-2-pent-4-enyl-1,3-dithiane?
The InChIKey is GISVTXCBFGZALC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O2S2/c1-4-5-6-10-17(20-11-7-12-21-17)14-8-9-15(18-2)16(13-14)19-3/h4,8-9,13H,1,5-7,10-12H2,2-3H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)-2-pent-4-enyl-1,3-dithiane?
2-(3,4-dimethoxyphenyl)-2-pent-4-enyl-1,3-dithiane has a molecular weight of 324.51 g/mol, XLogP of 5.08, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-2-pent-4-enyl-1,3-dithiane is sourced from PubChem (CID 71333117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).