About heptalene-2,3-dione
heptalene-2,3-dione (PubChem CID 71333397) has the molecular formula C12H8O2
and a molecular weight of 184.19 g/mol. Its IUPAC name is heptalene-2,3-dione.
Molecular Properties
| Compound Name | heptalene-2,3-dione |
| PubChem CID | 71333397 |
| Molecular Formula | C12H8O2 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | heptalene-2,3-dione |
| SMILES | O=c1ccc2cccccc-2cc1=O |
| InChI | InChI=1S/C12H8O2/c13-11-7-6-9-4-2-1-3-5-10(9)8-12(11)14/h1-8H |
| InChIKey | DJLUZSRDFDGYGS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze heptalene-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptalene-2,3-dione?
The IUPAC name of heptalene-2,3-dione (CID 71333397) is heptalene-2,3-dione.
What is the SMILES notation for heptalene-2,3-dione?
The canonical SMILES for heptalene-2,3-dione is O=c1ccc2cccccc-2cc1=O.
What is the InChIKey of heptalene-2,3-dione?
The InChIKey is DJLUZSRDFDGYGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O2/c13-11-7-6-9-4-2-1-3-5-10(9)8-12(11)14/h1-8H.
What are the key properties of heptalene-2,3-dione?
heptalene-2,3-dione has a molecular weight of 184.19 g/mol, XLogP of 1.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptalene-2,3-dione is sourced from PubChem (CID 71333397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).