About 7-(bromomethyl)-3-methyl-1,4,6-trioxaspiro[4.4]nonane
7-(bromomethyl)-3-methyl-1,4,6-trioxaspiro[4.4]nonane (PubChem CID 71333715) has the molecular formula C8H13BrO3
and a molecular weight of 237.09 g/mol. Its IUPAC name is 7-(bromomethyl)-3-methyl-1,4,6-trioxaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 7-(bromomethyl)-3-methyl-1,4,6-trioxaspiro[4.4]nonane |
| PubChem CID | 71333715 |
| Molecular Formula | C8H13BrO3 |
| Molecular Weight | 237.09 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | 7-(bromomethyl)-3-methyl-1,4,6-trioxaspiro[4.4]nonane |
| SMILES | CC1COC2(CCC(CBr)O2)O1 |
| InChI | InChI=1S/C8H13BrO3/c1-6-5-10-8(11-6)3-2-7(4-9)12-8/h6-7H,2-5H2,1H3 |
| InChIKey | CTXWCJRLACDITE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.09 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-(bromomethyl)-3-methyl-1,4,6-trioxaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(bromomethyl)-3-methyl-1,4,6-trioxaspiro[4.4]nonane?
The IUPAC name of 7-(bromomethyl)-3-methyl-1,4,6-trioxaspiro[4.4]nonane (CID 71333715) is 7-(bromomethyl)-3-methyl-1,4,6-trioxaspiro[4.4]nonane.
What is the SMILES notation for 7-(bromomethyl)-3-methyl-1,4,6-trioxaspiro[4.4]nonane?
The canonical SMILES for 7-(bromomethyl)-3-methyl-1,4,6-trioxaspiro[4.4]nonane is CC1COC2(CCC(CBr)O2)O1.
What is the InChIKey of 7-(bromomethyl)-3-methyl-1,4,6-trioxaspiro[4.4]nonane?
The InChIKey is CTXWCJRLACDITE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BrO3/c1-6-5-10-8(11-6)3-2-7(4-9)12-8/h6-7H,2-5H2,1H3.
What are the key properties of 7-(bromomethyl)-3-methyl-1,4,6-trioxaspiro[4.4]nonane?
7-(bromomethyl)-3-methyl-1,4,6-trioxaspiro[4.4]nonane has a molecular weight of 237.09 g/mol, XLogP of 1.65, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(bromomethyl)-3-methyl-1,4,6-trioxaspiro[4.4]nonane is sourced from PubChem (CID 71333715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).