C10H23N3 — CID 71333716
1-N,1-N,1-N',1-N',3-N,3-N,2-heptamethylprop-2-ene-1,1,3-triamine (PubChem CID 71333716) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',3-N,3-N,2-heptamethylprop-2-ene-1,1,3-triamine.
| Compound Name | 1-N,1-N,1-N',1-N',3-N,3-N,2-heptamethylprop-2-ene-1,1,3-triamine |
|---|---|
| PubChem CID | 71333716 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | 1-N,1-N,1-N',1-N',3-N,3-N,2-heptamethylprop-2-ene-1,1,3-triamine |
| SMILES | CC(=CN(C)C)C(N(C)C)N(C)C |
| InChI | InChI=1S/C10H23N3/c1-9(8-11(2)3)10(12(4)5)13(6)7/h8,10H,1-7H3 |
| InChIKey | MWQKCUNURPNJOW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|