About 3-propan-2-ylcyclohexa-3,5-diene-1,2-diol
3-propan-2-ylcyclohexa-3,5-diene-1,2-diol (PubChem CID 71333746) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 3-propan-2-ylcyclohexa-3,5-diene-1,2-diol.
Molecular Properties
| Compound Name | 3-propan-2-ylcyclohexa-3,5-diene-1,2-diol |
| PubChem CID | 71333746 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 3-propan-2-ylcyclohexa-3,5-diene-1,2-diol |
| SMILES | CC(C)C1=CC=CC(O)C1O |
| InChI | InChI=1S/C9H14O2/c1-6(2)7-4-3-5-8(10)9(7)11/h3-6,8-11H,1-2H3 |
| InChIKey | NYJNNUSDAYXEQI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propan-2-ylcyclohexa-3,5-diene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-ylcyclohexa-3,5-diene-1,2-diol?
The IUPAC name of 3-propan-2-ylcyclohexa-3,5-diene-1,2-diol (CID 71333746) is 3-propan-2-ylcyclohexa-3,5-diene-1,2-diol.
What is the SMILES notation for 3-propan-2-ylcyclohexa-3,5-diene-1,2-diol?
The canonical SMILES for 3-propan-2-ylcyclohexa-3,5-diene-1,2-diol is CC(C)C1=CC=CC(O)C1O.
What is the InChIKey of 3-propan-2-ylcyclohexa-3,5-diene-1,2-diol?
The InChIKey is NYJNNUSDAYXEQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-6(2)7-4-3-5-8(10)9(7)11/h3-6,8-11H,1-2H3.
What are the key properties of 3-propan-2-ylcyclohexa-3,5-diene-1,2-diol?
3-propan-2-ylcyclohexa-3,5-diene-1,2-diol has a molecular weight of 154.21 g/mol, XLogP of 0.86, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-ylcyclohexa-3,5-diene-1,2-diol is sourced from PubChem (CID 71333746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).