About 1-methylidene-5,6,7,8-tetrahydropyrrolizin-3-one
1-methylidene-5,6,7,8-tetrahydropyrrolizin-3-one (PubChem CID 71333769) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is 1-methylidene-5,6,7,8-tetrahydropyrrolizin-3-one.
Molecular Properties
| Compound Name | 1-methylidene-5,6,7,8-tetrahydropyrrolizin-3-one |
| PubChem CID | 71333769 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 1-methylidene-5,6,7,8-tetrahydropyrrolizin-3-one |
| SMILES | C=C1CC(=O)N2CCCC12 |
| InChI | InChI=1S/C8H11NO/c1-6-5-8(10)9-4-2-3-7(6)9/h7H,1-5H2 |
| InChIKey | VEENNOJJQUZEEE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methylidene-5,6,7,8-tetrahydropyrrolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylidene-5,6,7,8-tetrahydropyrrolizin-3-one?
The IUPAC name of 1-methylidene-5,6,7,8-tetrahydropyrrolizin-3-one (CID 71333769) is 1-methylidene-5,6,7,8-tetrahydropyrrolizin-3-one.
What is the SMILES notation for 1-methylidene-5,6,7,8-tetrahydropyrrolizin-3-one?
The canonical SMILES for 1-methylidene-5,6,7,8-tetrahydropyrrolizin-3-one is C=C1CC(=O)N2CCCC12.
What is the InChIKey of 1-methylidene-5,6,7,8-tetrahydropyrrolizin-3-one?
The InChIKey is VEENNOJJQUZEEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO/c1-6-5-8(10)9-4-2-3-7(6)9/h7H,1-5H2.
What are the key properties of 1-methylidene-5,6,7,8-tetrahydropyrrolizin-3-one?
1-methylidene-5,6,7,8-tetrahydropyrrolizin-3-one has a molecular weight of 137.18 g/mol, XLogP of 0.94, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylidene-5,6,7,8-tetrahydropyrrolizin-3-one is sourced from PubChem (CID 71333769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).