About 3,4-dihydroxy-7-methoxy-3H-1,4-benzoxazin-2-one
3,4-dihydroxy-7-methoxy-3H-1,4-benzoxazin-2-one (PubChem CID 71333801) has the molecular formula C9H9NO5
and a molecular weight of 211.17 g/mol. Its IUPAC name is 3,4-dihydroxy-7-methoxy-3H-1,4-benzoxazin-2-one.
Molecular Properties
| Compound Name | 3,4-dihydroxy-7-methoxy-3H-1,4-benzoxazin-2-one |
| PubChem CID | 71333801 |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 3,4-dihydroxy-7-methoxy-3H-1,4-benzoxazin-2-one |
| SMILES | COc1ccc2c(c1)OC(=O)C(O)N2O |
| InChI | InChI=1S/C9H9NO5/c1-14-5-2-3-6-7(4-5)15-9(12)8(11)10(6)13/h2-4,8,11,13H,1H3 |
| InChIKey | ZRTFIPGJFJLMCG-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydroxy-7-methoxy-3H-1,4-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydroxy-7-methoxy-3H-1,4-benzoxazin-2-one?
The IUPAC name of 3,4-dihydroxy-7-methoxy-3H-1,4-benzoxazin-2-one (CID 71333801) is 3,4-dihydroxy-7-methoxy-3H-1,4-benzoxazin-2-one.
What is the SMILES notation for 3,4-dihydroxy-7-methoxy-3H-1,4-benzoxazin-2-one?
The canonical SMILES for 3,4-dihydroxy-7-methoxy-3H-1,4-benzoxazin-2-one is COc1ccc2c(c1)OC(=O)C(O)N2O.
What is the InChIKey of 3,4-dihydroxy-7-methoxy-3H-1,4-benzoxazin-2-one?
The InChIKey is ZRTFIPGJFJLMCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO5/c1-14-5-2-3-6-7(4-5)15-9(12)8(11)10(6)13/h2-4,8,11,13H,1H3.
What are the key properties of 3,4-dihydroxy-7-methoxy-3H-1,4-benzoxazin-2-one?
3,4-dihydroxy-7-methoxy-3H-1,4-benzoxazin-2-one has a molecular weight of 211.17 g/mol, XLogP of 0.13, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxy-7-methoxy-3H-1,4-benzoxazin-2-one is sourced from PubChem (CID 71333801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).