C9H20Si — CID 71334156
2,2,3,3,4,4-hexamethylsiletane (PubChem CID 71334156) has the molecular formula C9H20Si and a molecular weight of 156.34 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexamethylsiletane.
| Compound Name | 2,2,3,3,4,4-hexamethylsiletane |
|---|---|
| PubChem CID | 71334156 |
| Molecular Formula | C9H20Si |
| Molecular Weight | 156.34 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 2,2,3,3,4,4-hexamethylsiletane |
| SMILES | CC1(C)[SiH2]C(C)(C)C1(C)C |
| InChI | InChI=1S/C9H20Si/c1-7(2)8(3,4)10-9(7,5)6/h10H2,1-6H3 |
| InChIKey | KBGXUMFLJLZTHT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|