About 4-(2-aminoethyl)-1,2-diphenylpyrazolidine-3,5-dione
4-(2-aminoethyl)-1,2-diphenylpyrazolidine-3,5-dione (PubChem CID 71334224) has the molecular formula C17H17N3O2
and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-(2-aminoethyl)-1,2-diphenylpyrazolidine-3,5-dione.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)-1,2-diphenylpyrazolidine-3,5-dione |
| PubChem CID | 71334224 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 4-(2-aminoethyl)-1,2-diphenylpyrazolidine-3,5-dione |
| SMILES | NCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H17N3O2/c18-12-11-15-16(21)19(13-7-3-1-4-8-13)20(17(15)22)14-9-5-2-6-10-14/h1-10,15H,11-12,18H2 |
| InChIKey | WMGQLPKJZRBHPB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-aminoethyl)-1,2-diphenylpyrazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)-1,2-diphenylpyrazolidine-3,5-dione?
The IUPAC name of 4-(2-aminoethyl)-1,2-diphenylpyrazolidine-3,5-dione (CID 71334224) is 4-(2-aminoethyl)-1,2-diphenylpyrazolidine-3,5-dione.
What is the SMILES notation for 4-(2-aminoethyl)-1,2-diphenylpyrazolidine-3,5-dione?
The canonical SMILES for 4-(2-aminoethyl)-1,2-diphenylpyrazolidine-3,5-dione is NCCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O.
What is the InChIKey of 4-(2-aminoethyl)-1,2-diphenylpyrazolidine-3,5-dione?
The InChIKey is WMGQLPKJZRBHPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O2/c18-12-11-15-16(21)19(13-7-3-1-4-8-13)20(17(15)22)14-9-5-2-6-10-14/h1-10,15H,11-12,18H2.
What are the key properties of 4-(2-aminoethyl)-1,2-diphenylpyrazolidine-3,5-dione?
4-(2-aminoethyl)-1,2-diphenylpyrazolidine-3,5-dione has a molecular weight of 295.34 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)-1,2-diphenylpyrazolidine-3,5-dione is sourced from PubChem (CID 71334224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).