C9H15Br2N — CID 71334492
3-(1,2-dibromoethyl)-1-azabicyclo[2.2.2]octane (PubChem CID 71334492) has the molecular formula C9H15Br2N and a molecular weight of 297.03 g/mol. Its IUPAC name is 3-(1,2-dibromoethyl)-1-azabicyclo[2.2.2]octane.
| Compound Name | 3-(1,2-dibromoethyl)-1-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 71334492 |
| Molecular Formula | C9H15Br2N |
| Molecular Weight | 297.03 g/mol |
| Exact Mass | 294.96 |
| IUPAC Name | 3-(1,2-dibromoethyl)-1-azabicyclo[2.2.2]octane |
| SMILES | BrCC(Br)C1CN2CCC1CC2 |
| InChI | InChI=1S/C9H15Br2N/c10-5-9(11)8-6-12-3-1-7(8)2-4-12/h7-9H,1-6H2 |
| InChIKey | PXIKJZPRJYBXGQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.03 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|