About 4-(1,3-dithian-2-ylidene)pentan-1-ol
4-(1,3-dithian-2-ylidene)pentan-1-ol (PubChem CID 71334589) has the molecular formula C9H16OS2
and a molecular weight of 204.36 g/mol. Its IUPAC name is 4-(1,3-dithian-2-ylidene)pentan-1-ol.
Molecular Properties
| Compound Name | 4-(1,3-dithian-2-ylidene)pentan-1-ol |
| PubChem CID | 71334589 |
| Molecular Formula | C9H16OS2 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 4-(1,3-dithian-2-ylidene)pentan-1-ol |
| SMILES | CC(CCCO)=C1SCCCS1 |
| InChI | InChI=1S/C9H16OS2/c1-8(4-2-5-10)9-11-6-3-7-12-9/h10H,2-7H2,1H3 |
| InChIKey | VUBXZTDBDZFKAT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,3-dithian-2-ylidene)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dithian-2-ylidene)pentan-1-ol?
The IUPAC name of 4-(1,3-dithian-2-ylidene)pentan-1-ol (CID 71334589) is 4-(1,3-dithian-2-ylidene)pentan-1-ol.
What is the SMILES notation for 4-(1,3-dithian-2-ylidene)pentan-1-ol?
The canonical SMILES for 4-(1,3-dithian-2-ylidene)pentan-1-ol is CC(CCCO)=C1SCCCS1.
What is the InChIKey of 4-(1,3-dithian-2-ylidene)pentan-1-ol?
The InChIKey is VUBXZTDBDZFKAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16OS2/c1-8(4-2-5-10)9-11-6-3-7-12-9/h10H,2-7H2,1H3.
What are the key properties of 4-(1,3-dithian-2-ylidene)pentan-1-ol?
4-(1,3-dithian-2-ylidene)pentan-1-ol has a molecular weight of 204.36 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dithian-2-ylidene)pentan-1-ol is sourced from PubChem (CID 71334589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).