About 1-(2,2-dichloroethoxy)ethanol
1-(2,2-dichloroethoxy)ethanol (PubChem CID 71334748) has the molecular formula C4H8Cl2O2
and a molecular weight of 159.01 g/mol. Its IUPAC name is 1-(2,2-dichloroethoxy)ethanol.
Molecular Properties
| Compound Name | 1-(2,2-dichloroethoxy)ethanol |
| PubChem CID | 71334748 |
| Molecular Formula | C4H8Cl2O2 |
| Molecular Weight | 159.01 g/mol |
| Exact Mass | 157.99 |
| IUPAC Name | 1-(2,2-dichloroethoxy)ethanol |
| SMILES | CC(O)OCC(Cl)Cl |
| InChI | InChI=1S/C4H8Cl2O2/c1-3(7)8-2-4(5)6/h3-4,7H,2H2,1H3 |
| InChIKey | NOWISTCUIZRHBG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.01 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dichloroethoxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dichloroethoxy)ethanol?
The IUPAC name of 1-(2,2-dichloroethoxy)ethanol (CID 71334748) is 1-(2,2-dichloroethoxy)ethanol.
What is the SMILES notation for 1-(2,2-dichloroethoxy)ethanol?
The canonical SMILES for 1-(2,2-dichloroethoxy)ethanol is CC(O)OCC(Cl)Cl.
What is the InChIKey of 1-(2,2-dichloroethoxy)ethanol?
The InChIKey is NOWISTCUIZRHBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8Cl2O2/c1-3(7)8-2-4(5)6/h3-4,7H,2H2,1H3.
What are the key properties of 1-(2,2-dichloroethoxy)ethanol?
1-(2,2-dichloroethoxy)ethanol has a molecular weight of 159.01 g/mol, XLogP of 1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dichloroethoxy)ethanol is sourced from PubChem (CID 71334748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).