About 3,5-ditert-butylbenzene-1,2-dithiol
3,5-ditert-butylbenzene-1,2-dithiol (PubChem CID 71334813) has the molecular formula C14H22S2
and a molecular weight of 254.46 g/mol. Its IUPAC name is 3,5-ditert-butylbenzene-1,2-dithiol.
Molecular Properties
| Compound Name | 3,5-ditert-butylbenzene-1,2-dithiol |
| PubChem CID | 71334813 |
| Molecular Formula | C14H22S2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3,5-ditert-butylbenzene-1,2-dithiol |
| SMILES | CC(C)(C)c1cc(S)c(S)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C14H22S2/c1-13(2,3)9-7-10(14(4,5)6)12(16)11(15)8-9/h7-8,15-16H,1-6H3 |
| InChIKey | MRFZCVJSHKARDG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3,5-ditert-butylbenzene-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-ditert-butylbenzene-1,2-dithiol?
The IUPAC name of 3,5-ditert-butylbenzene-1,2-dithiol (CID 71334813) is 3,5-ditert-butylbenzene-1,2-dithiol.
What is the SMILES notation for 3,5-ditert-butylbenzene-1,2-dithiol?
The canonical SMILES for 3,5-ditert-butylbenzene-1,2-dithiol is CC(C)(C)c1cc(S)c(S)c(C(C)(C)C)c1.
What is the InChIKey of 3,5-ditert-butylbenzene-1,2-dithiol?
The InChIKey is MRFZCVJSHKARDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22S2/c1-13(2,3)9-7-10(14(4,5)6)12(16)11(15)8-9/h7-8,15-16H,1-6H3.
What are the key properties of 3,5-ditert-butylbenzene-1,2-dithiol?
3,5-ditert-butylbenzene-1,2-dithiol has a molecular weight of 254.46 g/mol, XLogP of 4.86, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-ditert-butylbenzene-1,2-dithiol is sourced from PubChem (CID 71334813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).