C18H15ClN2S — CID 713351
(4S)-4-(4-chlorophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazoline-2-thione (PubChem CID 713351) has the molecular formula C18H15ClN2S and a molecular weight of 326.85 g/mol. Its IUPAC name is (4S)-4-(4-chlorophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazoline-2-thione.
| Compound Name | (4S)-4-(4-chlorophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazoline-2-thione |
|---|---|
| PubChem CID | 713351 |
| Molecular Formula | C18H15ClN2S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | (4S)-4-(4-chlorophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazoline-2-thione |
| SMILES | S=C1NC2=C(CCc3ccccc32)[C@H](c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C18H15ClN2S/c19-13-8-5-12(6-9-13)16-15-10-7-11-3-1-2-4-14(11)17(15)21-18(22)20-16/h1-6,8-9,16H,7,10H2,(H2,20,21,22)/t16-/m0/s1 |
| InChIKey | CEUVYLKUHIQWOL-INIZCTEOSA-N |
| XLogP | 4.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|